C15H25N5O3S3 — CID 121029119
1-methylsulfonyl-N-[5-(2-pyrrolidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide (PubChem CID 121029119) has the molecular formula C15H25N5O3S3 and a molecular weight of 419.60 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[5-(2-pyrrolidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-methylsulfonyl-N-[5-(2-pyrrolidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121029119 |
| Molecular Formula | C15H25N5O3S3 |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-methylsulfonyl-N-[5-(2-pyrrolidin-1-ylethylsulfanyl)-1,3,4-thiadiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Nc2nnc(SCCN3CCCC3)s2)CC1 |
| InChI | InChI=1S/C15H25N5O3S3/c1-26(22,23)20-8-4-12(5-9-20)13(21)16-14-17-18-15(25-14)24-11-10-19-6-2-3-7-19/h12H,2-11H2,1H3,(H,16,17,21) |
| InChIKey | ADFNUGOFKTUZFT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|