C16H14N4O2S — CID 121031340
2-(6-imidazol-1-ylpyridazin-3-yl)sulfanyl-1-(4-methoxyphenyl)ethanone (PubChem CID 121031340) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-(6-imidazol-1-ylpyridazin-3-yl)sulfanyl-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-(6-imidazol-1-ylpyridazin-3-yl)sulfanyl-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 121031340 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-(6-imidazol-1-ylpyridazin-3-yl)sulfanyl-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CSc2ccc(-n3ccnc3)nn2)cc1 |
| InChI | InChI=1S/C16H14N4O2S/c1-22-13-4-2-12(3-5-13)14(21)10-23-16-7-6-15(18-19-16)20-9-8-17-11-20/h2-9,11H,10H2,1H3 |
| InChIKey | PXDHOTHXFAUYME-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |