C14H18N4S — CID 121031417
3-cyclohexylsulfanyl-6-(2-methylimidazol-1-yl)pyridazine (PubChem CID 121031417) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-6-(2-methylimidazol-1-yl)pyridazine.
| Compound Name | 3-cyclohexylsulfanyl-6-(2-methylimidazol-1-yl)pyridazine |
|---|---|
| PubChem CID | 121031417 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-cyclohexylsulfanyl-6-(2-methylimidazol-1-yl)pyridazine |
| SMILES | Cc1nccn1-c1ccc(SC2CCCCC2)nn1 |
| InChI | InChI=1S/C14H18N4S/c1-11-15-9-10-18(11)13-7-8-14(17-16-13)19-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3 |
| InChIKey | UJKXQPJYPLFTTN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |