C21H27N5O3 — CID 121031903
(3-methoxyphenyl)-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]methanone (PubChem CID 121031903) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is (3-methoxyphenyl)-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]methanone.
| Compound Name | (3-methoxyphenyl)-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121031903 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (3-methoxyphenyl)-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]methanone |
| SMILES | COc1cccc(C(=O)N2CCN(c3nc(C)cc(N4CCOCC4)n3)CC2)c1 |
| InChI | InChI=1S/C21H27N5O3/c1-16-14-19(24-10-12-29-13-11-24)23-21(22-16)26-8-6-25(7-9-26)20(27)17-4-3-5-18(15-17)28-2/h3-5,14-15H,6-13H2,1-2H3 |
| InChIKey | IGWAQJAOTACKHY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |