C20H16N4O2 — CID 121033240
(E)-3-(furan-2-yl)-N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)prop-2-enamide (PubChem CID 121033240) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 121033240 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(-c2cn3cccnc3n2)cc1NC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C20H16N4O2/c1-14-5-6-15(18-13-24-10-3-9-21-20(24)23-18)12-17(14)22-19(25)8-7-16-4-2-11-26-16/h2-13H,1H3,(H,22,25)/b8-7+ |
| InChIKey | ICOPWGJHGAIVFO-BQYQJAHWSA-N |
| XLogP | 3.95 |
| TPSA | 72.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|