C19H15N3O3S — CID 121034526
N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 121034526) has the molecular formula C19H15N3O3S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 121034526 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCn1nc(-c2cccs2)ccc1=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H15N3O3S/c23-18-8-7-14(17-6-3-11-26-17)21-22(18)10-9-20-19(24)16-12-13-4-1-2-5-15(13)25-16/h1-8,11-12H,9-10H2,(H,20,24) |
| InChIKey | HSBJNTDBHHAGBS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |