C16H26N4O4 — CID 121036180
N-[2-(dimethylamino)ethyl]-N'-[2-(furan-2-yl)-2-morpholin-4-ylethyl]oxamide (PubChem CID 121036180) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-[2-(furan-2-yl)-2-morpholin-4-ylethyl]oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-[2-(furan-2-yl)-2-morpholin-4-ylethyl]oxamide |
|---|---|
| PubChem CID | 121036180 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-[2-(furan-2-yl)-2-morpholin-4-ylethyl]oxamide |
| SMILES | CN(C)CCNC(=O)C(=O)NCC(c1ccco1)N1CCOCC1 |
| InChI | InChI=1S/C16H26N4O4/c1-19(2)6-5-17-15(21)16(22)18-12-13(14-4-3-9-24-14)20-7-10-23-11-8-20/h3-4,9,13H,5-8,10-12H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | LNRZEEKKYXONFI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|