C19H12N6O — CID 121036202
3-cyano-N-[3-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide (PubChem CID 121036202) has the molecular formula C19H12N6O and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-cyano-N-[3-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide.
| Compound Name | 3-cyano-N-[3-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 121036202 |
| Molecular Formula | C19H12N6O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-cyano-N-[3-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2cccc(-c3ccc4nncn4n3)c2)c1 |
| InChI | InChI=1S/C19H12N6O/c20-11-13-3-1-5-15(9-13)19(26)22-16-6-2-4-14(10-16)17-7-8-18-23-21-12-25(18)24-17/h1-10,12H,(H,22,26) |
| InChIKey | IVBWVGFBLWIPGT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 95.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |