C18H18N6O4S — CID 121037094
2-(2,6-dioxopiperidin-1-yl)-N-[3-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]ethanesulfonamide (PubChem CID 121037094) has the molecular formula C18H18N6O4S and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-1-yl)-N-[3-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]ethanesulfonamide.
| Compound Name | 2-(2,6-dioxopiperidin-1-yl)-N-[3-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 121037094 |
| Molecular Formula | C18H18N6O4S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-(2,6-dioxopiperidin-1-yl)-N-[3-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]ethanesulfonamide |
| SMILES | O=C1CCCC(=O)N1CCS(=O)(=O)Nc1cccc(-c2ccc3nncn3n2)c1 |
| InChI | InChI=1S/C18H18N6O4S/c25-17-5-2-6-18(26)23(17)9-10-29(27,28)22-14-4-1-3-13(11-14)15-7-8-16-20-19-12-24(16)21-15/h1,3-4,7-8,11-12,22H,2,5-6,9-10H2 |
| InChIKey | CZBGZVFUPPGNNS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|