C22H30N6O2 — CID 121038204
[4-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]-(3-methoxyphenyl)methanone (PubChem CID 121038204) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is [4-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [4-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 121038204 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | [4-[6-(4-ethylpiperazin-1-yl)pyridazin-3-yl]piperazin-1-yl]-(3-methoxyphenyl)methanone |
| SMILES | CCN1CCN(c2ccc(N3CCN(C(=O)c4cccc(OC)c4)CC3)nn2)CC1 |
| InChI | InChI=1S/C22H30N6O2/c1-3-25-9-11-26(12-10-25)20-7-8-21(24-23-20)27-13-15-28(16-14-27)22(29)18-5-4-6-19(17-18)30-2/h4-8,17H,3,9-16H2,1-2H3 |
| InChIKey | NRIHUWHZYYXPNA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 65.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |