About N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide
N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide (PubChem CID 1210393) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide.
Molecular Properties
| Compound Name | N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide |
| PubChem CID | 1210393 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide |
| SMILES | Cc1cccc(C(=O)NNC2=CCC(C)(C)CC2=O)c1O |
| InChI | InChI=1S/C16H20N2O3/c1-10-5-4-6-11(14(10)20)15(21)18-17-12-7-8-16(2,3)9-13(12)19/h4-7,17,20H,8-9H2,1-3H3,(H,18,21) |
| InChIKey | JKMCOANIPQXPPT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide?
The IUPAC name of N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide (CID 1210393) is N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide.
What is the SMILES notation for N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide?
The canonical SMILES for N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide is Cc1cccc(C(=O)NNC2=CCC(C)(C)CC2=O)c1O.
What is the InChIKey of N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide?
The InChIKey is JKMCOANIPQXPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-10-5-4-6-11(14(10)20)15(21)18-17-12-7-8-16(2,3)9-13(12)19/h4-7,17,20H,8-9H2,1-3H3,(H,18,21).
What are the key properties of N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide?
N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide has a molecular weight of 288.35 g/mol, XLogP of 2.21, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,4-dimethyl-6-oxocyclohexen-1-yl)-2-hydroxy-3-methylbenzohydrazide is sourced from PubChem (CID 1210393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).