C27H17ClN2O5S — CID 121042877
3-[(4-chlorophenyl)sulfonylamino]-N-(9,10-dioxoanthracen-2-yl)benzamide (PubChem CID 121042877) has the molecular formula C27H17ClN2O5S and a molecular weight of 516.96 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-N-(9,10-dioxoanthracen-2-yl)benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(9,10-dioxoanthracen-2-yl)benzamide |
|---|---|
| PubChem CID | 121042877 |
| Molecular Formula | C27H17ClN2O5S |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(9,10-dioxoanthracen-2-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)c1ccccc1C2=O)c1cccc(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H17ClN2O5S/c28-17-8-11-20(12-9-17)36(34,35)30-19-5-3-4-16(14-19)27(33)29-18-10-13-23-24(15-18)26(32)22-7-2-1-6-21(22)25(23)31/h1-15,30H,(H,29,33) |
| InChIKey | WLTFJLIQRBUSHX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|