C27H32N4OS — CID 121046287
N-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2-(4-propan-2-ylsulfanylphenyl)acetamide (PubChem CID 121046287) has the molecular formula C27H32N4OS and a molecular weight of 460.65 g/mol. Its IUPAC name is N-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2-(4-propan-2-ylsulfanylphenyl)acetamide.
| Compound Name | N-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2-(4-propan-2-ylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 121046287 |
| Molecular Formula | C27H32N4OS |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | N-[4-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-2-(4-propan-2-ylsulfanylphenyl)acetamide |
| SMILES | CC(C)Sc1ccc(CC(=O)Nc2ccc(-c3ccc(N4CCCCCC4)nn3)cc2)cc1 |
| InChI | InChI=1S/C27H32N4OS/c1-20(2)33-24-13-7-21(8-14-24)19-27(32)28-23-11-9-22(10-12-23)25-15-16-26(30-29-25)31-17-5-3-4-6-18-31/h7-16,20H,3-6,17-19H2,1-2H3,(H,28,32) |
| InChIKey | YEVSMIGNLGNRFR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |