C17H17N3O4 — CID 121048633
N-[[3-(2-methoxyethyl)-4-oxophthalazin-1-yl]methyl]furan-2-carboxamide (PubChem CID 121048633) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-[[3-(2-methoxyethyl)-4-oxophthalazin-1-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[[3-(2-methoxyethyl)-4-oxophthalazin-1-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 121048633 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[[3-(2-methoxyethyl)-4-oxophthalazin-1-yl]methyl]furan-2-carboxamide |
| SMILES | COCCn1nc(CNC(=O)c2ccco2)c2ccccc2c1=O |
| InChI | InChI=1S/C17H17N3O4/c1-23-10-8-20-17(22)13-6-3-2-5-12(13)14(19-20)11-18-16(21)15-7-4-9-24-15/h2-7,9H,8,10-11H2,1H3,(H,18,21) |
| InChIKey | AJBPYVDMKQYJRG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |