C17H13N5O2S — CID 121049976
N-(1H-indazol-6-yl)-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)acetamide (PubChem CID 121049976) has the molecular formula C17H13N5O2S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-(1H-indazol-6-yl)-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)acetamide.
| Compound Name | N-(1H-indazol-6-yl)-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 121049976 |
| Molecular Formula | C17H13N5O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-(1H-indazol-6-yl)-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)acetamide |
| SMILES | O=C(Cn1nc(-c2cccs2)ccc1=O)Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C17H13N5O2S/c23-16(19-12-4-3-11-9-18-20-14(11)8-12)10-22-17(24)6-5-13(21-22)15-2-1-7-25-15/h1-9H,10H2,(H,18,20)(H,19,23) |
| InChIKey | IRIYFQUBPGVNMD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |