C18H19N5O3S2 — CID 121050018
2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 121050018) has the molecular formula C18H19N5O3S2 and a molecular weight of 417.52 g/mol. Its IUPAC name is 2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 121050018 |
| Molecular Formula | C18H19N5O3S2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCOc1ccc(-c2ccc(=O)n(CC(=O)Nc3nnc(SCC)s3)n2)cc1 |
| InChI | InChI=1S/C18H19N5O3S2/c1-3-26-13-7-5-12(6-8-13)14-9-10-16(25)23(22-14)11-15(24)19-17-20-21-18(28-17)27-4-2/h5-10H,3-4,11H2,1-2H3,(H,19,20,24) |
| InChIKey | BYZNNUCSXHZLCN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|