C21H23N5O5 — CID 121050261
2-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-[3-(6-oxopyridazin-1-yl)propyl]acetamide (PubChem CID 121050261) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-[3-(6-oxopyridazin-1-yl)propyl]acetamide.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-[3-(6-oxopyridazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 121050261 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]-N-[3-(6-oxopyridazin-1-yl)propyl]acetamide |
| SMILES | COc1ccc(-c2ccc(=O)n(CC(=O)NCCCn3ncccc3=O)n2)cc1OC |
| InChI | InChI=1S/C21H23N5O5/c1-30-17-8-6-15(13-18(17)31-2)16-7-9-21(29)26(24-16)14-19(27)22-10-4-12-25-20(28)5-3-11-23-25/h3,5-9,11,13H,4,10,12,14H2,1-2H3,(H,22,27) |
| InChIKey | ZXISFDSVOPUEMO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|