C26H23N3O3 — CID 121050299
N-benzyl-2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-phenylacetamide (PubChem CID 121050299) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-benzyl-2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-phenylacetamide.
| Compound Name | N-benzyl-2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 121050299 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-benzyl-2-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-phenylacetamide |
| SMILES | COc1ccc(-c2ccc(=O)n(CC(=O)N(Cc3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H23N3O3/c1-32-23-14-12-21(13-15-23)24-16-17-25(30)29(27-24)19-26(31)28(22-10-6-3-7-11-22)18-20-8-4-2-5-9-20/h2-17H,18-19H2,1H3 |
| InChIKey | IJKGSQDJTMCASS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |