C25H26N4O4 — CID 121050347
2-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-6-(4-methoxyphenyl)pyridazin-3-one (PubChem CID 121050347) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-6-(4-methoxyphenyl)pyridazin-3-one.
| Compound Name | 2-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-6-(4-methoxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 121050347 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-6-(4-methoxyphenyl)pyridazin-3-one |
| SMILES | COc1ccc(-c2ccc(=O)n(CC(=O)N3CCN(c4ccc(C(C)=O)cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-18(30)19-3-7-21(8-4-19)27-13-15-28(16-14-27)25(32)17-29-24(31)12-11-23(26-29)20-5-9-22(33-2)10-6-20/h3-12H,13-17H2,1-2H3 |
| InChIKey | RDOGAYCFXZIXPR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |