C21H17N5O5 — CID 121050453
N-(2-cyano-4-nitrophenyl)-2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]acetamide (PubChem CID 121050453) has the molecular formula C21H17N5O5 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]acetamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]acetamide |
|---|---|
| PubChem CID | 121050453 |
| Molecular Formula | C21H17N5O5 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-2-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]acetamide |
| SMILES | CCOc1ccc(-c2ccc(=O)n(CC(=O)Nc3ccc([N+](=O)[O-])cc3C#N)n2)cc1 |
| InChI | InChI=1S/C21H17N5O5/c1-2-31-17-6-3-14(4-7-17)19-9-10-21(28)25(24-19)13-20(27)23-18-8-5-16(26(29)30)11-15(18)12-22/h3-11H,2,13H2,1H3,(H,23,27) |
| InChIKey | SYNPWUWIDBJSQP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|