C17H19FN4O4S — CID 121051551
6-(4-fluorophenyl)-2-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]pyridazin-3-one (PubChem CID 121051551) has the molecular formula C17H19FN4O4S and a molecular weight of 394.43 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]pyridazin-3-one.
| Compound Name | 6-(4-fluorophenyl)-2-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 121051551 |
| Molecular Formula | C17H19FN4O4S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 6-(4-fluorophenyl)-2-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]pyridazin-3-one |
| SMILES | CS(=O)(=O)N1CCN(C(=O)Cn2nc(-c3ccc(F)cc3)ccc2=O)CC1 |
| InChI | InChI=1S/C17H19FN4O4S/c1-27(25,26)21-10-8-20(9-11-21)17(24)12-22-16(23)7-6-15(19-22)13-2-4-14(18)5-3-13/h2-7H,8-12H2,1H3 |
| InChIKey | DPFIVCAMCOFQBP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |