C21H20N4O4 — CID 121051950
2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 121051950) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 121051950 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-[3-(2,5-dimethylphenyl)-6-oxopyridazin-1-yl]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | Cc1ccc(C)c(-c2ccc(=O)n(CC(=O)Nc3cc([N+](=O)[O-])ccc3C)n2)c1 |
| InChI | InChI=1S/C21H20N4O4/c1-13-4-5-14(2)17(10-13)18-8-9-21(27)24(23-18)12-20(26)22-19-11-16(25(28)29)7-6-15(19)3/h4-11H,12H2,1-3H3,(H,22,26) |
| InChIKey | KJAMIRLHWJQYTC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|