C23H31N5O2 — CID 121053530
1-[4-[6-(2-ethylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]-2-phenoxyethanone (PubChem CID 121053530) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[4-[6-(2-ethylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-[6-(2-ethylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 121053530 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 1-[4-[6-(2-ethylpiperidin-1-yl)pyridazin-3-yl]piperazin-1-yl]-2-phenoxyethanone |
| SMILES | CCC1CCCCN1c1ccc(N2CCN(C(=O)COc3ccccc3)CC2)nn1 |
| InChI | InChI=1S/C23H31N5O2/c1-2-19-8-6-7-13-28(19)22-12-11-21(24-25-22)26-14-16-27(17-15-26)23(29)18-30-20-9-4-3-5-10-20/h3-5,9-12,19H,2,6-8,13-18H2,1H3 |
| InChIKey | NWURINBMOGLFRF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |