C21H27N7O4 — CID 121053630
[4-[6-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazin-3-yl]piperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 121053630) has the molecular formula C21H27N7O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is [4-[6-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazin-3-yl]piperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [4-[6-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazin-3-yl]piperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 121053630 |
| Molecular Formula | C21H27N7O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | [4-[6-[4-(2-hydroxyethyl)piperazin-1-yl]pyridazin-3-yl]piperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCN(c2ccc(N3CCN(CCO)CC3)nn2)CC1 |
| InChI | InChI=1S/C21H27N7O4/c29-15-14-24-6-8-25(9-7-24)19-4-5-20(23-22-19)26-10-12-27(13-11-26)21(30)17-2-1-3-18(16-17)28(31)32/h1-5,16,29H,6-15H2 |
| InChIKey | MZHVWBRHJCDORH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|