C19H18F3N3O4S — CID 121054557
N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-N-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 121054557) has the molecular formula C19H18F3N3O4S and a molecular weight of 441.43 g/mol. Its IUPAC name is N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-N-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-N-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 121054557 |
| Molecular Formula | C19H18F3N3O4S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N'-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methylphenyl]-N-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | Cc1ccc(N2CCCS2(=O)=O)cc1NC(=O)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3N3O4S/c1-12-6-7-15(25-8-3-9-30(25,28)29)11-16(12)24-18(27)17(26)23-14-5-2-4-13(10-14)19(20,21)22/h2,4-7,10-11H,3,8-9H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | JUIWVOIPJAODEL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|