C19H18Cl2N2OS2 — CID 121055335
4-benzylsulfanyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 121055335) has the molecular formula C19H18Cl2N2OS2 and a molecular weight of 425.41 g/mol. Its IUPAC name is 4-benzylsulfanyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-benzylsulfanyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 121055335 |
| Molecular Formula | C19H18Cl2N2OS2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 4-benzylsulfanyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | Cn1/c(=N/C(=O)CCCSCc2ccccc2)sc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C19H18Cl2N2OS2/c1-23-17-14(20)9-10-15(21)18(17)26-19(23)22-16(24)8-5-11-25-12-13-6-3-2-4-7-13/h2-4,6-7,9-10H,5,8,11-12H2,1H3/b22-19- |
| InChIKey | PIPHTFQKRNVKQS-QOCHGBHMSA-N |
| XLogP | 5.69 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|