C19H15IN4O2S — CID 121055508
N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)-4-iodobenzenesulfonamide (PubChem CID 121055508) has the molecular formula C19H15IN4O2S and a molecular weight of 490.33 g/mol. Its IUPAC name is N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)-4-iodobenzenesulfonamide.
| Compound Name | N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 121055508 |
| Molecular Formula | C19H15IN4O2S |
| Molecular Weight | 490.33 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | N-(5-imidazo[1,2-a]pyrimidin-2-yl-2-methylphenyl)-4-iodobenzenesulfonamide |
| SMILES | Cc1ccc(-c2cn3cccnc3n2)cc1NS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C19H15IN4O2S/c1-13-3-4-14(18-12-24-10-2-9-21-19(24)22-18)11-17(13)23-27(25,26)16-7-5-15(20)6-8-16/h2-12,23H,1H3 |
| InChIKey | DWZOWWDZNFFVSX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|