C22H18FN5O2 — CID 121057985
(E)-N-[2-[[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-3-phenylprop-2-enamide (PubChem CID 121057985) has the molecular formula C22H18FN5O2 and a molecular weight of 403.42 g/mol. Its IUPAC name is (E)-N-[2-[[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 121057985 |
| Molecular Formula | C22H18FN5O2 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (E)-N-[2-[[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy]ethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCCOc1ccc2nnc(-c3ccc(F)cc3)n2n1 |
| InChI | InChI=1S/C22H18FN5O2/c23-18-9-7-17(8-10-18)22-26-25-19-11-13-21(27-28(19)22)30-15-14-24-20(29)12-6-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,24,29)/b12-6+ |
| InChIKey | ZDIHBZAMGFJYAQ-WUXMJOGZSA-N |
| XLogP | 3.14 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|