C18H19N5O3 — CID 121059097
3-(3-methoxyphenyl)-N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 121059097) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(3-methoxyphenyl)-N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 121059097 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 3-(3-methoxyphenyl)-N-[2-(3-methyl-6-oxopyridazin-1-yl)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NCCn3nc(C)ccc3=O)[nH]n2)c1 |
| InChI | InChI=1S/C18H19N5O3/c1-12-6-7-17(24)23(22-12)9-8-19-18(25)16-11-15(20-21-16)13-4-3-5-14(10-13)26-2/h3-7,10-11H,8-9H2,1-2H3,(H,19,25)(H,20,21) |
| InChIKey | UYFWRTYNHUKLOY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |