C18H22N4O4 — CID 121064479
N-[4-(2-acetamidoethoxy)phenyl]-2-(4-ethyl-6-oxopyrimidin-1-yl)acetamide (PubChem CID 121064479) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[4-(2-acetamidoethoxy)phenyl]-2-(4-ethyl-6-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-[4-(2-acetamidoethoxy)phenyl]-2-(4-ethyl-6-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 121064479 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[4-(2-acetamidoethoxy)phenyl]-2-(4-ethyl-6-oxopyrimidin-1-yl)acetamide |
| SMILES | CCc1cc(=O)n(CC(=O)Nc2ccc(OCCNC(C)=O)cc2)cn1 |
| InChI | InChI=1S/C18H22N4O4/c1-3-14-10-18(25)22(12-20-14)11-17(24)21-15-4-6-16(7-5-15)26-9-8-19-13(2)23/h4-7,10,12H,3,8-9,11H2,1-2H3,(H,19,23)(H,21,24) |
| InChIKey | WGTJJNRXANGWGT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|