C19H19N5O3 — CID 121066688
1-[(4-methylphenyl)methyl]-6-oxo-N-[2-(6-oxopyridazin-1-yl)ethyl]pyridazine-3-carboxamide (PubChem CID 121066688) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-6-oxo-N-[2-(6-oxopyridazin-1-yl)ethyl]pyridazine-3-carboxamide.
| Compound Name | 1-[(4-methylphenyl)methyl]-6-oxo-N-[2-(6-oxopyridazin-1-yl)ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 121066688 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-6-oxo-N-[2-(6-oxopyridazin-1-yl)ethyl]pyridazine-3-carboxamide |
| SMILES | Cc1ccc(Cn2nc(C(=O)NCCn3ncccc3=O)ccc2=O)cc1 |
| InChI | InChI=1S/C19H19N5O3/c1-14-4-6-15(7-5-14)13-24-18(26)9-8-16(22-24)19(27)20-11-12-23-17(25)3-2-10-21-23/h2-10H,11-13H2,1H3,(H,20,27) |
| InChIKey | XCVFTSQLBOGCAV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |