C13H19N3O3 — CID 121066845
6-(2,6-dimethylmorpholine-4-carbonyl)-2-ethylpyridazin-3-one (PubChem CID 121066845) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 6-(2,6-dimethylmorpholine-4-carbonyl)-2-ethylpyridazin-3-one.
| Compound Name | 6-(2,6-dimethylmorpholine-4-carbonyl)-2-ethylpyridazin-3-one |
|---|---|
| PubChem CID | 121066845 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 6-(2,6-dimethylmorpholine-4-carbonyl)-2-ethylpyridazin-3-one |
| SMILES | CCn1nc(C(=O)N2CC(C)OC(C)C2)ccc1=O |
| InChI | InChI=1S/C13H19N3O3/c1-4-16-12(17)6-5-11(14-16)13(18)15-7-9(2)19-10(3)8-15/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | QKKSOMIRGWNXHX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |