C23H20N6O4S — CID 121067015
1-benzyl-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-6-oxopyridazine-3-carboxamide (PubChem CID 121067015) has the molecular formula C23H20N6O4S and a molecular weight of 476.52 g/mol. Its IUPAC name is 1-benzyl-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-benzyl-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 121067015 |
| Molecular Formula | C23H20N6O4S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 1-benzyl-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1ccnc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(=O)n(Cc4ccccc4)n3)cc2)n1 |
| InChI | InChI=1S/C23H20N6O4S/c1-16-13-14-24-23(25-16)28-34(32,33)19-9-7-18(8-10-19)26-22(31)20-11-12-21(30)29(27-20)15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,26,31)(H,24,25,28) |
| InChIKey | YOXNNJRSHJIUIF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |