C22H20N4O6 — CID 121069011
1-[3-[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]-2-(4-nitrophenyl)ethanone (PubChem CID 121069011) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is 1-[3-[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]-2-(4-nitrophenyl)ethanone.
| Compound Name | 1-[3-[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]-2-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 121069011 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 1-[3-[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]-2-(4-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCCC(c2nnc(-c3ccc4c(c3)OCO4)o2)C1 |
| InChI | InChI=1S/C22H20N4O6/c27-20(10-14-3-6-17(7-4-14)26(28)29)25-9-1-2-16(12-25)22-24-23-21(32-22)15-5-8-18-19(11-15)31-13-30-18/h3-8,11,16H,1-2,9-10,12-13H2 |
| InChIKey | KIBYCFWABKGTRH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 120.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|