C19H19FN4O4 — CID 121069465
1-[2-[3-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 121069465) has the molecular formula C19H19FN4O4 and a molecular weight of 386.38 g/mol. Its IUPAC name is 1-[2-[3-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[3-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 121069465 |
| Molecular Formula | C19H19FN4O4 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[2-[3-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CN1C(=O)CCC1=O)N1CCCC(c2nnc(-c3ccc(F)cc3)o2)C1 |
| InChI | InChI=1S/C19H19FN4O4/c20-14-5-3-12(4-6-14)18-21-22-19(28-18)13-2-1-9-23(10-13)17(27)11-24-15(25)7-8-16(24)26/h3-6,13H,1-2,7-11H2 |
| InChIKey | WYKARSCSMGZRCD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|