C20H24N6O5 — CID 121070037
2-[3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 121070037) has the molecular formula C20H24N6O5 and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-[3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 121070037 |
| Molecular Formula | C20H24N6O5 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-[3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | Cn1c(C2CCN(C(=O)C3CC3)CC2)nn(CC(=O)Nc2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C20H24N6O5/c1-23-18(13-8-10-24(11-9-13)19(28)14-2-3-14)22-25(20(23)29)12-17(27)21-15-4-6-16(7-5-15)26(30)31/h4-7,13-14H,2-3,8-12H2,1H3,(H,21,27) |
| InChIKey | JRJDBVXKCDCTDJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|