C26H29N5O3 — CID 121071260
N-[4-(2-acetamidoethoxy)phenyl]-1-(6-phenylpyridazin-3-yl)piperidine-3-carboxamide (PubChem CID 121071260) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[4-(2-acetamidoethoxy)phenyl]-1-(6-phenylpyridazin-3-yl)piperidine-3-carboxamide.
| Compound Name | N-[4-(2-acetamidoethoxy)phenyl]-1-(6-phenylpyridazin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071260 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[4-(2-acetamidoethoxy)phenyl]-1-(6-phenylpyridazin-3-yl)piperidine-3-carboxamide |
| SMILES | CC(=O)NCCOc1ccc(NC(=O)C2CCCN(c3ccc(-c4ccccc4)nn3)C2)cc1 |
| InChI | InChI=1S/C26H29N5O3/c1-19(32)27-15-17-34-23-11-9-22(10-12-23)28-26(33)21-8-5-16-31(18-21)25-14-13-24(29-30-25)20-6-3-2-4-7-20/h2-4,6-7,9-14,21H,5,8,15-18H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | GTZZQBXXKDEHRK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|