C23H22BrFN4O — CID 121071302
N-(4-bromo-3-methylphenyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-3-carboxamide (PubChem CID 121071302) has the molecular formula C23H22BrFN4O and a molecular weight of 469.36 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-3-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121071302 |
| Molecular Formula | C23H22BrFN4O |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-1-[6-(4-fluorophenyl)pyridazin-3-yl]piperidine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCCN(c3ccc(-c4ccc(F)cc4)nn3)C2)ccc1Br |
| InChI | InChI=1S/C23H22BrFN4O/c1-15-13-19(8-9-20(15)24)26-23(30)17-3-2-12-29(14-17)22-11-10-21(27-28-22)16-4-6-18(25)7-5-16/h4-11,13,17H,2-3,12,14H2,1H3,(H,26,30) |
| InChIKey | BXVOVHXYOUPOKJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |