C21H19F3N4O3 — CID 121071725
1-[6-(furan-2-yl)pyridazin-3-yl]-N-[2-(trifluoromethoxy)phenyl]piperidine-4-carboxamide (PubChem CID 121071725) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is 1-[6-(furan-2-yl)pyridazin-3-yl]-N-[2-(trifluoromethoxy)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[6-(furan-2-yl)pyridazin-3-yl]-N-[2-(trifluoromethoxy)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121071725 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-[6-(furan-2-yl)pyridazin-3-yl]-N-[2-(trifluoromethoxy)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)C1CCN(c2ccc(-c3ccco3)nn2)CC1 |
| InChI | InChI=1S/C21H19F3N4O3/c22-21(23,24)31-18-5-2-1-4-15(18)25-20(29)14-9-11-28(12-10-14)19-8-7-16(26-27-19)17-6-3-13-30-17/h1-8,13-14H,9-12H2,(H,25,29) |
| InChIKey | QVJOAGFVWHSCNP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |