C18H19BrN6O — CID 121072408
4-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 121072408) has the molecular formula C18H19BrN6O and a molecular weight of 415.30 g/mol. Its IUPAC name is 4-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 121072408 |
| Molecular Formula | C18H19BrN6O |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 4-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1cc(C)n(-c2cc(NCCNC(=O)c3ccc(Br)cc3)ncn2)n1 |
| InChI | InChI=1S/C18H19BrN6O/c1-12-9-13(2)25(24-12)17-10-16(22-11-23-17)20-7-8-21-18(26)14-3-5-15(19)6-4-14/h3-6,9-11H,7-8H2,1-2H3,(H,21,26)(H,20,22,23) |
| InChIKey | VVNBERDBLVKFHA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|