C23H25F3N6O3 — CID 121073259
N-(4-butoxyphenyl)-4-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]piperazine-1-carboxamide (PubChem CID 121073259) has the molecular formula C23H25F3N6O3 and a molecular weight of 490.49 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-4-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]piperazine-1-carboxamide.
| Compound Name | N-(4-butoxyphenyl)-4-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 121073259 |
| Molecular Formula | C23H25F3N6O3 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-(4-butoxyphenyl)-4-[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]piperazine-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)N2CCN(c3ccc(-c4noc(C(F)(F)F)n4)cn3)CC2)cc1 |
| InChI | InChI=1S/C23H25F3N6O3/c1-2-3-14-34-18-7-5-17(6-8-18)28-22(33)32-12-10-31(11-13-32)19-9-4-16(15-27-19)20-29-21(35-30-20)23(24,25)26/h4-9,15H,2-3,10-14H2,1H3,(H,28,33) |
| InChIKey | AUUYZCQBZMAFEW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|