C18H25N5O2 — CID 121074582
N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-phenoxypropanamide (PubChem CID 121074582) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-phenoxypropanamide.
| Compound Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-phenoxypropanamide |
|---|---|
| PubChem CID | 121074582 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-2-phenoxypropanamide |
| SMILES | CCNc1cc(NCCNC(=O)C(C)Oc2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C18H25N5O2/c1-4-19-16-12-17(23-14(3)22-16)20-10-11-21-18(24)13(2)25-15-8-6-5-7-9-15/h5-9,12-13H,4,10-11H2,1-3H3,(H,21,24)(H2,19,20,22,23) |
| InChIKey | XSJNPRYLWVPMAN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|