C19H15N5O5 — CID 121076332
N-(2-cyano-4-nitrophenyl)-2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]-2-methylpropanamide (PubChem CID 121076332) has the molecular formula C19H15N5O5 and a molecular weight of 393.36 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]-2-methylpropanamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 121076332 |
| Molecular Formula | C19H15N5O5 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-2-[3-(furan-2-yl)-6-oxopyridazin-1-yl]-2-methylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc([N+](=O)[O-])cc1C#N)n1nc(-c2ccco2)ccc1=O |
| InChI | InChI=1S/C19H15N5O5/c1-19(2,23-17(25)8-7-15(22-23)16-4-3-9-29-16)18(26)21-14-6-5-13(24(27)28)10-12(14)11-20/h3-10H,1-2H3,(H,21,26) |
| InChIKey | LHMSFJSVUJKCHA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|