C18H13N5O4S — CID 121076580
N-(2-cyano-4-nitrophenyl)-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)propanamide (PubChem CID 121076580) has the molecular formula C18H13N5O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is N-(2-cyano-4-nitrophenyl)-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)propanamide.
| Compound Name | N-(2-cyano-4-nitrophenyl)-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)propanamide |
|---|---|
| PubChem CID | 121076580 |
| Molecular Formula | C18H13N5O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-(2-cyano-4-nitrophenyl)-2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc([N+](=O)[O-])cc1C#N)n1nc(-c2cccs2)ccc1=O |
| InChI | InChI=1S/C18H13N5O4S/c1-11(22-17(24)7-6-15(21-22)16-3-2-8-28-16)18(25)20-14-5-4-13(23(26)27)9-12(14)10-19/h2-9,11H,1H3,(H,20,25) |
| InChIKey | GUQOXJUBJLZAEN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|