C23H27N3O — CID 121080156
1-phenyl-N-(3,3,5-trimethylcyclohexyl)benzimidazole-5-carboxamide (PubChem CID 121080156) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-phenyl-N-(3,3,5-trimethylcyclohexyl)benzimidazole-5-carboxamide.
| Compound Name | 1-phenyl-N-(3,3,5-trimethylcyclohexyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 121080156 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-phenyl-N-(3,3,5-trimethylcyclohexyl)benzimidazole-5-carboxamide |
| SMILES | CC1CC(NC(=O)c2ccc3c(c2)ncn3-c2ccccc2)CC(C)(C)C1 |
| InChI | InChI=1S/C23H27N3O/c1-16-11-18(14-23(2,3)13-16)25-22(27)17-9-10-21-20(12-17)24-15-26(21)19-7-5-4-6-8-19/h4-10,12,15-16,18H,11,13-14H2,1-3H3,(H,25,27) |
| InChIKey | TTYUXXOAQXHMIL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |