About 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea
1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea (PubChem CID 121082162) has the molecular formula C12H14BrN3OS
and a molecular weight of 328.24 g/mol. Its IUPAC name is 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea.
Molecular Properties
| Compound Name | 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea |
| PubChem CID | 121082162 |
| Molecular Formula | C12H14BrN3OS |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea |
| SMILES | CC(C)(C)NC(=O)Nc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C12H14BrN3OS/c1-12(2,3)16-10(17)15-11-14-8-5-4-7(13)6-9(8)18-11/h4-6H,1-3H3,(H2,14,15,16,17) |
| InChIKey | QMRUQJLRXWOWRR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea?
The IUPAC name of 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea (CID 121082162) is 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea.
What is the SMILES notation for 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea?
The canonical SMILES for 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea is CC(C)(C)NC(=O)Nc1nc2ccc(Br)cc2s1.
What is the InChIKey of 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea?
The InChIKey is QMRUQJLRXWOWRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN3OS/c1-12(2,3)16-10(17)15-11-14-8-5-4-7(13)6-9(8)18-11/h4-6H,1-3H3,(H2,14,15,16,17).
What are the key properties of 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea?
1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea has a molecular weight of 328.24 g/mol, XLogP of 3.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-1,3-benzothiazol-2-yl)-3-tert-butylurea is sourced from PubChem (CID 121082162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).