C13H16ClN3OS — CID 121082431
1-tert-butyl-3-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)urea (PubChem CID 121082431) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 1-tert-butyl-3-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-tert-butyl-3-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 121082431 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-tert-butyl-3-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)urea |
| SMILES | Cc1c(Cl)ccc2sc(NC(=O)NC(C)(C)C)nc12 |
| InChI | InChI=1S/C13H16ClN3OS/c1-7-8(14)5-6-9-10(7)15-12(19-9)16-11(18)17-13(2,3)4/h5-6H,1-4H3,(H2,15,16,17,18) |
| InChIKey | GRPFRTVJFNGFCY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |