C16H14FN3OS — CID 121082993
3-(dimethylamino)-N-(4-fluoro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 121082993) has the molecular formula C16H14FN3OS and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(dimethylamino)-N-(4-fluoro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-(dimethylamino)-N-(4-fluoro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 121082993 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-(dimethylamino)-N-(4-fluoro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CN(C)c1cccc(C(=O)Nc2nc3c(F)cccc3s2)c1 |
| InChI | InChI=1S/C16H14FN3OS/c1-20(2)11-6-3-5-10(9-11)15(21)19-16-18-14-12(17)7-4-8-13(14)22-16/h3-9H,1-2H3,(H,18,19,21) |
| InChIKey | HYHLANAEVNXTRF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |