C15H13NO3S — CID 121083749
7-methoxy-N-(thiophen-2-ylmethyl)-1-benzofuran-2-carboxamide (PubChem CID 121083749) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 7-methoxy-N-(thiophen-2-ylmethyl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-(thiophen-2-ylmethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 121083749 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 7-methoxy-N-(thiophen-2-ylmethyl)-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NCc3cccs3)oc12 |
| InChI | InChI=1S/C15H13NO3S/c1-18-12-6-2-4-10-8-13(19-14(10)12)15(17)16-9-11-5-3-7-20-11/h2-8H,9H2,1H3,(H,16,17) |
| InChIKey | DXIVGNQXMAGEMG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |