C21H19FN2O — CID 121084436
4-fluoro-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 121084436) has the molecular formula C21H19FN2O and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-fluoro-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-fluoro-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 121084436 |
| Molecular Formula | C21H19FN2O |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-fluoro-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(F)cc1)N(CCc1ccccc1)Cc1ccccn1 |
| InChI | InChI=1S/C21H19FN2O/c22-19-11-9-18(10-12-19)21(25)24(16-20-8-4-5-14-23-20)15-13-17-6-2-1-3-7-17/h1-12,14H,13,15-16H2 |
| InChIKey | LVMCEROYLDIGTG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |